Repositioning Candidate Details
| Candidate ID: | R0917 |
| Source ID: | DB06045 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Trofinetide |
| Synonyms: | Trofinetide |
| Molecular Formula: | C13H21N3O6 |
| SMILES: | C[C@]1(CCCN1C(=O)CN)C(=O)N[C@@H](CCC(O)=O)C(O)=O |
| Structure: |
|
| DrugBank Description: | Trofinetide (NNZ-2566), a neuroprotective analogue of , is a novel molecule that has a profile suitable for both intravenous infusion and chronic oral delivery. It is currently in development to treat traumatic brain injury. |
| CAS Number: | 853400-76-7 |
| Molecular Weight: | 315.326 |
| DrugBank Indication: | Investigated for use/treatment in traumatic brain injuries. |
| DrugBank Pharmacology: | NNZ-2566 is shown to have multi-faceted action to significantly reduce both inflammation and apoptosis (cell death), protecting the neurons and their surrounding infrastructure. |
| DrugBank MoA: | -- |
| Targets: | -- |
| Inclusion Criteria: | Therapeutic strategy associated |
