Repositioning Candidate Details
| Candidate ID: | R0955 |
| Source ID: | DB06246 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Exisulind |
| Synonyms: | 5-Fluoro-2-methyl-1-((Z)-p-(methylsulfonyl)benzylidene)indene-3-acetic acid; cis-5-Fluoro-2-methyl-1-(p-methylsulfonylbenzylidenyl)indene-3-acetic acid; Exisulind; Sulindac sulfone |
| Molecular Formula: | C20H17FO4S |
| SMILES: | CC1=C(CC(O)=O)C2=CC(F)=CC=C2\C1=C/C1=CC=C(C=C1)S(C)(=O)=O |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 59973-80-7 |
| Molecular Weight: | 372.41 |
| DrugBank Indication: | Investigated for use/treatment in adenomatous polyposis coli, lung cancer, prostate cancer, colon polyps, Barrett's esophagus disease, and pediatric indications. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | Exisulind is a sulindac derivative of a class of compounds called selective apoptotic anti-neoplastic drugs (SAANDs), which inhibit the enzyme cyclic guanosine monophosphodiesterase (cGMP - PDE). Exisulind is specific for apoptotic effects in precancerous and cancerous colorectal cells due to their overexpression of cGMP. Sustained elevation of cGMP and protein kinase G (PKG) activation may be also implicated in the induction of apoptosis by Exisulind. |
| Targets: | cAMP-specific 3',5'-cyclic phosphodiesterase 4D; cAMP-specific 3',5'-cyclic phosphodiesterase 4C; cGMP-specific 3',5'-cyclic phosphodiesterase; cGMP-dependent 3',5'-cyclic phosphodiesterase; Glutathione S-transferase P inhibitor; Aldose reductase inhibitor; Aldo-keto reductase family 1 member B10 inhibitor |
| Inclusion Criteria: | Therapeutic strategy associated |
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|