Repositioning Candidate Details
| Candidate ID: | R0976 |
| Source ID: | DB06307 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Apoptone |
| Synonyms: | -- |
| Molecular Formula: | C21H32O2 |
| SMILES: | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](O)CC[C@]34C)[C@@H]1CC[C@@]2(O)C#C |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 183387-50-0 |
| Molecular Weight: | 316.485 |
| DrugBank Indication: | Investigated for use/treatment in cancer/tumors (unspecified). |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | HE3235 is a second generation antitumor agent that causes apoptosis (cell death). HE3235 inhibits the BCL2 gene which translates proteins that prevent apoptosis and stimulates the expression proteins that induce apoptosis. HE3235 also downregulates the gene that codes for the multi-drug resistant protein ABCG2 (BCRP1 – Breast Cancer Resistance Protein1). |
| Targets: | Apoptosis regulator Bcl-2 |
| Inclusion Criteria: | Therapeutic strategy associated |
