Repositioning Candidate Details
| Candidate ID: | R0979 |
| Source ID: | DB06314 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | SGX-523 |
| Synonyms: | 6-{[6-(1-methyl-1H-pyrazol-4-yl)[1,2,4]triazolo[4,3-b]pyridazin-3-yl]sulfanyl}quinoline |
| Molecular Formula: | C18H13N7S |
| SMILES: | CN1C=C(C=N1)C1=NN2C(SC3=CC=C4N=CC=CC4=C3)=NN=C2C=C1 |
| Structure: |
|
| DrugBank Description: | A MET receptor tyrosine kinase inhibitor. |
| CAS Number: | 1022150-57-7 |
| Molecular Weight: | 359.408 |
| DrugBank Indication: | Investigated for use/treatment in solid tumors and cancer/tumors (unspecified). |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | SGX523 is selective inhibitor of the receptor tyrosine kinase MET. MET is implicated in development and progression of cancer. SGX523 ihibits MET autophosphorylation and signalling, as well as activates cysteine-aspartic acid protease 3 (caspase 3), an enzyme which is part of the apoptosis signalling cascade. |
| Targets: | Hepatocyte growth factor receptor |
| Inclusion Criteria: | Therapeutic strategy associated |
