Repositioning Candidate Details
| Candidate ID: | R0993 |
| Source ID: | DB06362 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Becatecarin |
| Synonyms: | Becatecarin |
| Molecular Formula: | C33H34Cl2N4O7 |
| SMILES: | CCN(CC)CCN1C(=O)C2=C(C1=O)C1=C(N([C@@H]3O[C@H](CO)[C@@H](OC)[C@H](O)[C@H]3O)C3=C(Cl)C=CC=C13)C1=C2C2=C(N1)C(Cl)=CC=C2 |
| Structure: |
|
| DrugBank Description: | Becatecarin is a derivative of . |
| CAS Number: | 119673-08-4 |
| Molecular Weight: | 669.56 |
| DrugBank Indication: | Investigated for use/treatment in cancer/tumors (unspecified), liver cancer, gastric cancer, and leukemia (unspecified). |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | Becatecarin is a small molecule, anticancer compound for the treatment of hepatobiliary duct tumors, a rare and aggressive form of cancer with a high medical need and very limited survival. Becatecarin intercalates into DNA and stabilizes the DNA-topoisomerase I complex, thereby interfering with the topoisomerase I-catalyzed DNA breakage-reunion reaction and initiating DNA cleavage and apoptosis. |
| Targets: | DNA topoisomerase 2-alpha; DNA topoisomerase 2-beta |
| Inclusion Criteria: | Therapeutic strategy associated |
