Natural Product Details
Structure:
| Product ID: | N01165 |
| Product Name: | -- |
| CAS No: | -- |
| Molecular Formula: | C15H22O |
| SMILES: | CC1=CCC(C)(C)C=CC(=O)C(C)=CCC1 |
| InChiKey: | GIHNTRQPEMKFKO-UHFFFAOYSA-N |
| Category: | Terpenoids |
| Biological Source: |
