Natural Product Details
Structure:
| Product ID: | N01221 |
| Product Name: | -- |
| CAS No: | 36700422 |
| Molecular Formula: | C21H30O6 |
| SMILES: | CCCCC[C@@H](CC(=O)CCc1ccc(OC(C)=O)c(OC)c1)OC(C)=O |
| InChiKey: | PBYHUELMIHUJFS-IBGZPJMESA-N |
| Category: | -- |
| Biological Source: |
