Natural Product Details
Structure:
| Product ID: | N00147 |
| Product Name: | -- |
| CAS No: | 120993864 |
| Molecular Formula: | C18H18N2O2 |
| SMILES: | Cc1cc(O)c2c(-c3ccc([O-])cc3)n3[n+](c2c1)CCCC3 |
| InChiKey: | BYNDPWUDABJNCH-UHFFFAOYSA-N |
| Category: | -- |
| Biological Source: |
