Natural Product Details
Structure:
| Product ID: | N01478 |
| Product Name: | -- |
| CAS No: | 143114936 |
| Molecular Formula: | C17H24O4 |
| SMILES: | CCCCC(O)/C=C/C(=O)CCc1ccc(O)c(OC)c1 |
| InChiKey: | SEWFXECKZBLANJ-MDZDMXLPSA-N |
| Category: | -- |
| Biological Source: |
