Natural Product Details
Structure:
| Product ID: | N01512 |
| Product Name: | 7-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
| CAS No: | 718639102 |
| Molecular Formula: | C21H26O7 |
| SMILES: | COc1cc(CCC(=O)CC(O)CCc2cc(O)c(O)c(OC)c2)ccc1O |
| InChiKey: | JHWWZAIWXYIMDH-UHFFFAOYSA-N |
| Category: | Shikimates and Phenylpropanoids |
| Biological Source: |
