Natural Product Details
Structure:
| Product ID: | N01584 |
| Product Name: | 1,7 -dihydroxy- xanthone |
| CAS No: | 529613 |
| Molecular Formula: | C13H8O4 |
| SMILES: | O=c1c2cc(O)ccc2oc2cccc(O)c12 |
| InChiKey: | KDXFPEKLLFWHMN-UHFFFAOYSA-N |
| Category: | Shikimates and Phenylpropanoids |
| Biological Source: |
