Natural Product Details
Structure:
| Product ID: | N01927 |
| Product Name: | Naphthalene,1,2,3,5,6,8a-hexahydro-4,7-dimethyl-1- (1-methylethyl) |
| CAS No: | 16729014 |
| Molecular Formula: | C15H24 |
| SMILES: | CC1=CC2C(=C(C)CCC2C(C)C)CC1 |
| InChiKey: | FUCYIEXQVQJBKY-UHFFFAOYSA-N |
| Category: | Terpenoids |
| Biological Source: |
