Natural Product Details
Structure:
| Product ID: | N01936 |
| Product Name: | Heptadecane,2,6,10,14-tetramethyl- |
| CAS No: | 18344371 |
| Molecular Formula: | C21H44 |
| SMILES: | CCCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChiKey: | CIGFWENQAXVDOM-UHFFFAOYSA-N |
| Category: | Fatty acids |
| Biological Source: |
