Natural Product Details
Structure:
| Product ID: | N00267 |
| Product Name: | -- |
| CAS No: | 96562855 |
| Molecular Formula: | C12H13NO3 |
| SMILES: | COc1cc2cc[n+]([O-])c(C)c2cc1OC |
| InChiKey: | GVQWAJKTFATJEW-UHFFFAOYSA-N |
| Category: | -- |
| Biological Source: |
