Natural Product Details
Structure:
| Product ID: | N00326 |
| Product Name: | -- |
| CAS No: | 165467630 |
| Molecular Formula: | C13H12O4 |
| SMILES: | CC1(C)C=Cc2c(cc3c(c2O)C(=O)OC3)O1 |
| InChiKey: | ZYOUEEMPKPNVQW-UHFFFAOYSA-N |
| Category: | Polyketides |
| Biological Source: |
