Repositioning Candidate Details
| Candidate ID: | R0904 |
| Source ID: | DB05959 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | ENMD-1198 |
| Synonyms: | -- |
| Molecular Formula: | C20H25NO2 |
| SMILES: | COC1=C(C=C2CC[C@H]3[C@@H]4CC=C[C@@]4(C)CC[C@@H]3C2=C1)C(N)=O |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 864668-87-1 |
| Molecular Weight: | 311.425 |
| DrugBank Indication: | Investigated for use/treatment in cancer/tumors (unspecified) and solid tumors. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | ENMD-1198, a new chemical entity (NCE) based on a modified chemical structure of 2-methoxyestradiol (2ME2), is designed to decrease metabolism while retaining 2ME2's multiple mechanisms of action, including inducing apoptosis, disrupting microtubules, and inhibiting HIF-1 alpha. In preclinical studies, ENMD-1198 has been shown to be an orally active, antimitotic agent that leads to arrest of cell division and apoptosis in tumor cells. It also exerts antiangiogenic activity that further contributes to its overall antitumor effects. |
| Targets: | Tumor necrosis factor receptor superfamily member 11A; Hypoxia-inducible factor 1-alpha; Signal transducer and activator of transcription 3 |
| Inclusion Criteria: | Therapeutic strategy associated |
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|