Repositioning Candidate Details
| Candidate ID: | R0906 |
| Source ID: | DB05968 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | PR-104 |
| Synonyms: | -- |
| Molecular Formula: | C14H20BrN4O12PS |
| SMILES: | CS(=O)(=O)OCCN(CCBr)C1=C(C=C(C=C1[N+]([O-])=O)[N+]([O-])=O)C(=O)NCCOP(O)(O)=O |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 851627-62-8 |
| Molecular Weight: | 579.27 |
| DrugBank Indication: | Investigated for use/treatment in cancer/tumors (unspecified) and solid tumors. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | PR-104 is a novel hypoxia-activated DNA cross-linking agent with marked activity against human tumor xenografts, both as monotherapy and combined with radiotherapy and chemotherapy. Upon intravenous administration, PR-104 is converted by systemic phosphatases to the alcohol intermediate PR-104A, which is reduced to form the active DNA-crosslinking mustard species hydroxylamine PR-104H intracellularly under hypoxic conditions. PR-104H specifically crosslinks hypoxic tumor cell DNA, resulting in the inhibition of DNA repair and synthesis, cell-cycle arrest, and apoptosis in susceptible hypoxic tumor cell populations while sparing normoxic tissues. |
| Targets: | Tumor necrosis factor |
| Inclusion Criteria: | Therapeutic strategy associated |
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|